| Trimedlure |

Last updated: 03/02/2026
|
 |
(Also known as: mediterranean fruit fly pheromone; TML) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A synthetic analogue of a natural kairomone insect attractant used to control fruit flies |
|
|
Mediterranean fruit flies |
|
|
Citrus crops |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
- |
|
|
Expired |
|
|
- |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
A complex chiral molecule. The technical material is an isomeric mixture of 8 isomers - 4 trans (A, B1, B2 & C) and 4 cis (V, W, V, Y) forms. Isomer C is the most attractive to Mediterranean fruit flies |
|
|
C₁₂H₂₁ClO₂ |
|
|
CC1CC(CCC1C(=O)OC(C)(C)C)Cl |
|
|
No data |
|
|
WXTJNIRCHYDKBK-UHFFFAOYSA-N |
|
|
InChI=1S/C12H21ClO2/c1-8-7-9(13)5-6-10(8)11(14)15-12(2,3)4/h8-10H,5-7H2,1-4H3 |
|
|
Yes |
|
|
Semiochemical; Insecticide |
|
|
Pheromone |
|
|
- |
|
|
- |
|
|
Synthetic |
|
|
Non-toxic mode of action. Acts as an attractant |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
12002-53-8 |
|
|
234-416-0 |
|
|
8348 |
|
|
112603 |
|
|
- |
|
|
232.75 |
|
|
- |
|
|
tert-butyl (+/-)-4(or 5)-chloro-2-methylcyclohexanecarboxylate |
|
|
1,1-dimethylethyl 4(or 5)-chloro-2-methylcyclohexanecarboxylate |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
UNM |
|
|
Not applicable |
|
|
- |
|
|
Water-white liquid |
|
|
|
|
|
|
|
|
Current |
|
|
2001, first registration USA |
|
|
|
|
|
- Trimedlure Magnet Plug (BF L076)
- FT Trimedlure
|
|
|
Usually supplied into slow release formulations |
|
|
Trimedlure is commercially synthesised through a stereoselective esterification process involving cyclohexane-based intermediates and chloromethylation, yielding a potent blend of isomers used as a pheromone. The production begins with the preparation of cyclohexene carboxylic acid derivatives, which are chloromethylated to introduce the key functional group responsible for insect attraction. This intermediate is then esterified with tert-butyl alcohol under acidic conditions, typically using sulphuric acid or a Lewis acid catalyst, to form the tert-butyl ester. The reaction is carefully controlled to favour the formation of the active stereoisomers, particularly the (1R,2S,5R) and (1R,2S,4R) configurations, which exhibit the highest biological activity |
|
|
There is no publicly available life cycle assessment or peer-reviewed estimate of CO₂-e emissions specifically for the synthesis of trimedlure. However, a rough estimate can be made based on industry averages for fine chemical synthesis, the carbon intensity typically ranges from 5 to 50 kg CO₂-e per kg of product, depending on process efficiency, energy source, and waste treatment. For trimedlure, which is produced in relatively small volumes and requires stereoselective synthesis and purification, a mid-to-high estimate of 20–30 kg CO₂-e/kg is likely. |
|
|
|
|
|
|
|
|
|
|
1000 |
P4 P = Other non-EU, UK or US Governments and Regulators 4 = Verified data |
Moderate |
|
|
- |
- |
- |
|
|
Not applicable |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.98 X 1004 |
Calculated |
- |
|
|
4.6 |
|
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1 |
|
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source |
Slightly mobile |
|
|
2625 |
|
|
Estimated |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 4556 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2000 |
Colinus virginianus |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
9.6 |
Oncorhynchus mykiss |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
Toxic |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
455.6 |
Worst case of acute and chronic mammals |
|
|
200 |
Worst case of acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.096 |
Worst case of temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 4556 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 2025 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
2.9 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
| No data found |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H315, H319 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
trimedlure |
|
|
trimedlure |
|
|
Trimedlur |
|
|
trimedlure |
|
|
trimedlure |
|
|
trimedlure |
|
|
- |
|
|
trimedlur |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
03/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.