| Rotenone (Ref: ENT 133) |

Last updated: 27/03/2026
|
 |
(Also known as: derris root; derris; haiari; barbasco; aker-root) |
| A naturally occurring chemical with multiple crop protection applications. It is moderately toxic. It is not environmentally persistent degrading in soil in a few days. It is not expected to leach from soil or contaminate groundwaters. It is highly toxic to all aquatic organisms, earthworms and to honeybees. |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
A insecticide within the class of rotenones which is now used mainly in fish management and for the control of a wide range of arthropod pests including aphids, thrips and spider mites. Also has livestock applications. |
|
|
Aphids; Thrips; Beetles; Spider mites; Mosqiito larvae in wate; Lice; Fleas; Ticks |
|
|
Fish; Domestic pets; Fruit; Vegetables; Livestock |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Expired |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
France |
|
|
Expired |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Rotenone exhibits stereoisomerism due to the presence of multiple chiral centres in its complex fused-ring structure. The molecule contains a 5′-isopropenyl group that can exist in either the alpha- or beta-configuration, leading to different stereoisomers such as rotenone (5′beta-rotenone), epirotenone (5′beta-epirotenone), and their respective antipodes. |
|
|
C₂₃H₂₂O₆ |
|
|
CC(=C)C1CC2=C(O1)C=CC3=C2OC4COC5=CC(=C(C=C5C4C3=O)OC)OC |
|
|
CC(=C)[C@H]1CC2=C(O1)C=CC3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@H]4C3=O)OC)OC |
|
|
JUVIOZPCNVVQFO-HBGVWJBISA-N |
|
|
InChI=1S/C23H22O6/c1-11(2)16-8-14-15(28-16)6-5-12-22(24)21-13-7-18(25-3)19(26-4)9-17(13)27-10-20(21)29-23(12)14/h5-7,9,16,20-21H,1,8,10H2,2-4H3/t16-,20-,21+/m1/s1 |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| rotenone |
- |
 |
|
|
Insecticide; Acaricide; Veterinary substance |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Selective, non-systemic with contact and stomach action. Mitochondrial complex I electron transport inhibitor. |
|
|
Neurotoxin (energy depletion) |
|
|
Occurs naturally in the roots and stems of several plants of the genus Lonchocarpus and Derris |
|
|
Crop protection; public health applications; animal health |
|
|
- |
|
|
83-79-4 |
|
|
201-501-9 |
|
|
38 |
|
|
071003 |
|
|
- |
|
|
394.42 |
|
|
- |
|
|
(2R,6aS,12aS)-1,2,6,6a,12,12a-hexahydro-2-isopropenyl-8,9-dimethoxychromeno[3,4-b]furo[2,3-h]chromen-6-one |
|
|
(2R,6aS,12aS)-1,2,12,12a-tetrahydro-8,9-dimethoxy-2-(1-methylethenyl)(1)benzopyrano(3,4-b)furo(2,3-h)(1)benzopyran-6(6aH)-one |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R09 Rule 9: Pesticide active ingredients that have demonstrated a high aquatic toxicity (where acute ecotoxicity for fish, invertebrates or algae =< 0.1 mg l⁻¹) ; R10 Rule 10: Pesticide active ingredients that have demonstrated a high toxicity to bees (where contact or oral bee toxicity =< 2 μg bee⁻¹) ] |
|
|
Marine pollutant |
|
|
Not applicable |
|
|
Not applicable |
|
|
21B |
|
|
Not applicable |
|
|
Epilachna varivestis, Leptinotarsa decemlineata |
|
|
White powder |
|
|
|
|
|
Current |
|
|
Circa 1935, introduced; 2008, withdrawn EU |
|
|
- Prentiss Incorporated
- Vipesco
- Nantong Shenyu Green Medicine Co. Ltd.
|
|
|
- Derris
- Cube
- Timbo
- Barbasco
- Nekoe
- Prentox Cube Powder
- Vironone
|
|
|
Usually formulated as an emulsifiable concentrate or dust |
|
|
The commercial production of rotenone primarily involves extraction from the roots and stems of certain tropical and subtropical leguminous plants, such as Derris, Lonchocarpus and Tephrosia species. These plants are cultivated, harvested and prepared for extraction. The extraction process typically uses organic solvents like ethanol or chloroform to isolate rotenone from the plant material. After extraction, the compound is purified through crystallisation or chromatography to obtain a concentrated form suitable for use. |
|
|
Data for the amount of life cycle GHGs produced by rotenone are not available in the public domain. However, whilst estimates vary, more general data suggests that between 14 and 19 kilograms of CO₂e is emitted per kilogram of insecticide produced. |
|
|
|
|
|
|
|
|
|
|
15.0 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source |
Moderate |
|
|
- |
- |
- |
|
|
163 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
215 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
1.45 X 1004 |
Calculated |
- |
|
|
4.16 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.67 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
1.0 |
|
Low volatility. If applied directly to plants or soil, drift is a concern & mitigation is advisable |
|
|
1.13 X 10-08 |
|
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
2 |
|
Non-persistent |
|
|
3 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Best available data |
|
|
|
2.5 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range1.8-3.3 days, 2 field grown crops, various matrices, n=2 |
|
|
|
2.6 |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
Published literature RL₅₀ range 1.2-4.0 days, 2 field grown crops, various matrices, n=3 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
1.3 |
C4 C = AGRITOX dataset. Dataset is no longer available. 4 = Verified data |
Non-persistent |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Non-mobile |
|
|
10000 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 132 |
Rat |
Moderate |
|
|
10 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Dog |
Moderate |
|
|
- |
- |
- |
|
|
> 2600 |
Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 150 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Eisenia foetida |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
> 0.24 |
Apis mellifera |
High |
|
|
> 12 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Apis mellifera |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
> 0.68 |
R3 R = Peer reviewed scientific publications 3 = Unverified data of known source Bombus terrestris 72 hr |
High |
| Literature LD₅₀ values range 0.17-0.97 µg bee⁻¹ |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
> 6.5 |
Chrysoperla carnea Larva |
Moderate |
|
|
Harmful |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Aphidius rhopalosiphi |
- |
|
|
Moderately harmful |
AA2 AA = IOBC Database on classification of side effects to beneficial organisms, 2005 2 = Unverified data of unknown source Typhlodromus pyri |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
0.0019 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Oncorhynchus mykiss |
High |
|
|
0.0012 |
Oncorhynchus mykiss 32 day LOEC |
High |
|
|
0.011 |
Danio rerio Embryo |
High |
|
|
0.004 |
Daphnia magna |
High |
|
|
0.001 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Daphnia magna |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.0057 |
P3 P = Other non-EU, UK or US Governments and Regulators 3 = Unverified data of known source Unknown species |
High |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
2 |
Worst case of acute and chronic mammals |
|
|
260 |
Worst case of acute and chronic birds |
|
|
15 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
0.0048 |
Worst case of contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
1.9E-05 |
Worst case of temperate acute and chronic fish |
|
|
4E-05 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.00057 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 132 |
Rat |
Moderate |
|
|
10 |
Q2 Q = Miscellaneous data from online sources 2 = Unverified data of unknown source Dog |
Moderate |
|
|
- |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
0.019 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rat |
- |
|
|
Intravenous LD₅₀ = 0.20 mg kg⁻¹ |
Rat |
- |
| Subcutaneous LD₅₀ = 20.0 mg kg⁻¹ |
Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Around 20% of the administered dose is rapidly eliminated within 24 hrs in urine |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
XNo, known not to cause a problem |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
?Possibly, status not identified |
?Possibly, status not identified |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Moderately toxic |
|
|
|
|
|
IMDG Transport Hazard Classr 6.1 |
|
|
Health: H301, H315, H319, H335 Environment: H400, H410 |
|
|
II (Moderately hazardous) |
|
|
UN2811 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
rotenone |
|
|
rotenone |
|
|
Rotenon |
|
|
rotenon |
|
|
rotenone |
|
|
rotenona |
|
|
- |
|
|
rotenon |
|
|
rotenon |
|
|
- |
|
|
rotenon |
|
|
- |
| Record last updated: |
27/03/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.