| Pulegone |

Last updated: 22/02/2026
|
 |
(Also known as: (+)-pulegone; d-pulegone; (R)-(+)-enantiomer) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|   |
|
|
  |
|
|
A botanical substance, common in some plant essential oils, that exhibits bioactivity |
|
|
Fleas; General insects including mites, whiteflies, aphids, mosquitoes, weevils, ants; Various fungal pathogen and microorganisms |
|
|
Stored grains; Domestic households and gardens |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a pest control agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Pulegone exhibits optical isomerism due to a single chiral centre at the carbon bearing the methyl group (position 5). This results in two enantiomers: the naturally predominant (R)-(+)-pulegone and the less common (S)-(-)-pulegone. No geometrical (E/Z) isomerism occurs at the C=C bond because the two substituents on the terminal carbon are identical methyl groups. Other potential isomers, such as isopulegone, are constitutional (structural) isomers rather than stereoisomers of pulegone itself. |
|
|
C₁₀H₁₆O |
|
|
C[C@@H]1CCC(=C(C)C)C(=O)C1 |
|
|
- |
|
|
NZGWDASTMWDZIW-MRVPVSSYSA-N |
|
|
InChI=1S/C10H16O/c1-7(2)9-5-4-8(3)6-10(9)11/h8H,4-6H2,1-3H3/t8-/m1/s1 |
|
|
Yes |
|
|
Repellent; Insecticide; Fungicide; Antimicrobial; Other substance |
|
|
Flavouring; Fragrance |
|
|
Plant-derived substance; Monoterpene ketone |
|
|
- |
|
|
- |
|
|
Natural |
|
|
The mode of action is not fully clear and is multifaceted. As an insecticide, it has neurotoxic effects, acting as positive allosteric modulators of insect GABA receptors, potentially disrupting neurotransmission and leading to hyperexcitation, paralysis or death. It can also inhibit key insect enzymes leading to oxidative stress, accumulation of damaging reactive species, and enhanced vulnerability to the compound itself or mixtures. It acts as an antifeedant, disrupting probing/feeding behaviour and may affect oviposition or embryonic development in eggs. It’s strong odour contributes to its insect repellency. As a fungicide in inhibits mycelial growth, respiration and thought to deactivate fungi by disrupting the structure and function of fungal cell membranes and organelles. |
|
|
- |
|
|
A botanical substance commonly found in some plants especially pennyroyal oil (Mentha pulegium) and various mints |
|
|
Crop protection; Domestic and public health applications |
|
|
- |
|
|
89-82-7 |
|
|
3391-90-0; 15932-80-6 |
|
|
201-943-2 |
|
|
- |
|
|
- |
|
|
442495 |
|
|
152.23 |
|
|
- |
|
|
(5R)-5-methyl-2-propan-2-ylidenecyclohexan-1-one |
|
|
cyclohexanone, 5-methyl-2-(1-methylethylidene)-, (5R)- |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
FEMA=2963 |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
- |
|
|
A colourless to slightly yellow oily liquid with a sight minty, resinous odour |
|
|
|
|
|
|
|
|
Current |
|
|
- |
|
|
- Not currently produced specifically for pest management
|
|
|
- |
|
|
- |
|
|
Pulegone is commercially produced primarily through natural extraction from essential oils, especially pennyroyal mint (Mentha pulegium), of the volatile oil obtained by steam distillation of the leaves and flowering tops of the plant, cultivated mainly for this purpose in regions supporting mint production. Synthetic production is possible but not common due to sufficient natural supply and toxicity-related market constraints. Small quantities are also obtainable via in vitro shoot cultures of peppermint (Mentha piperita) in fermenters but these are not significant for bulk commercial output. |
|
|
Data for specific plant oils is scarce. However, from publicly available data the carbon footprint of plant oils has been estimated at between 1.0 and 4.0 kg CO₂e per kg of oil. This depends on the plant oil content, agricultural practices and processing methods used. |
|
|
|
|
|
|
|
|
|
|
173.7 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source at 25 °C |
Moderate |
|
|
Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Ethanol |
- |
| Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Chloroform |
- |
| Miscible |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Carbon tetrachloride |
- |
|
|
- |
- |
- |
|
|
224 |
|
- |
|
|
- |
- |
- |
|
|
88 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
|
1.58 X 1003 |
Calculated |
- |
|
|
3.2 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
High |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.93 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Peaks at 253 nm (in methanol) with minor absorbance between 290-700 nm |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
Readily biodegradable |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
| Known soil and groundwater metabolites |
|
None
|
|
|
|
|
| - |
2-(2-hydroxy-1-methylethyl)-5-methylcyclohexanone |
Humans |
- |
| - |
3-hydroxy-3-methyl-6-(1-methylethyl)cyclohexanone |
Humans |
- |
| - |
3-methyl-6-(1-methylethyl)cyclohexanol |
Humans |
- |
| - |
E-2-(2-hydroxy-1-methylethylidene)-5-methylcyclohexanone |
Humans |
- |
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
400 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
> 80 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
> 18.75 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mice NOAEL |
Moderate |
|
|
< 1.0 |
Colinus virginianus |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.1 |
Apis mellifera |
High |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
18.56 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Unknown species |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
24.4 |
Daphnia magna |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
3.75 |
Worst case of acute and chronic mammals |
|
|
0.1 |
Worst case of acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
0.1856 |
Worst case of temperate acute and chronic fish |
|
|
0.244 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
Moderate (class II) |
- |
- |
|
|
400 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
> 80 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Rat |
Moderate |
|
|
> 18.75 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Mice NOAEL |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
Intravenous LD₅₀ = 330 mg kg⁻¹ |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source Dog |
- |
|
|
0.07 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
?Possibly, status not identified |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
✓Yes, known to cause a problem |
XNo, known not to cause a problem |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
Hepatotoxic High exposure may increase liver/kidney weights, hyaline glomerulopathy, bile duct hyperplasia, and hepatocyte hypertrophy IARC Group 2B, possibly carcinogenic to humans |
|
|
|
|
|
Combustible |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
Sensitive to light - store in a dark place; Stable under recommended storage condition |
|
|
|
|
|
pulegone |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
22/02/2026 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.