| Capsaicin (Ref: NCI-C56564) |

Last updated: 13/10/2025
|
 |
(Also known as: chilli pepper dust; Capsicum oleoresin; hot pepper extract; axsain; zacin) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
A botanical substances used as a bird, animal and insect repellent. |
|
|
Mammals including deer, hares, rabbits and wild boar; Damaging insects |
|
|
Vegetables; Turf; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not approved |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
None |
|
|
C₁₈H₂₇NO₃ |
|
|
CC(C)C=CCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
|
|
CC(C)/C=C/CCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
|
|
YKPUWZUDDOIDPM-SOFGYWHQSA-N |
|
|
InChI=1S/C18H27NO3/c1-14(2)8-6-4-5-7-9-18(21)19-13-15-10-11-16(20)17(12-15)22-3/h6,8,10-12,14,20H,4-5,7,9,13H2,1-3H3,(H,19,21)/b8-6+ |
|
|
Yes |
| Cambridge Crystallographic Data Centre diagrams |
|
|
| Common Name |
Relationship |
Link |
| capsaicin |
- |
 |
|
|
Repellent; Insecticide; Miticide; Rodenticide |
|
|
Plant-derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
In insects, capsaicin causes metabolic disruption, membrane damage and nervous system failure. Also has a physical repellent action. |
|
|
- |
|
|
Derived from plants belonging to the genus Capsicum including the Capsicum red chili pepper |
|
|
Crop protection; Household pest control; Land management |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
404-86-4 |
|
|
206-969-8 |
|
|
- |
|
|
070701 |
|
|
1548943 |
|
|
305.42 |
|
|
- |
|
|
8-methyl-n-vanillyl-6-nonenamide |
|
|
(E)-N-((4-hydroxy-3-methoxyphenyl)-methyl)-8-methyl-6-nonenamide |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not known |
|
|
Not applicable |
|
|
- |
|
|
Dark red waxy solid when pure with a volatile pungent odour |
|
|
|
|
|
Current |
|
|
1816 first extracted; 1962, first registered USA |
|
|
- Aversion Technologies Inc., USA
- Hot Pepper Wax, Inc.
|
|
|
- Capsaicin
- Hot Pepper Wax Natural Insect Repellent
- Amorex
|
|
|
Available as granular, dust and liquid formulations with capsaicin alone or in combination with other active biopesticides |
|
|
Capsaicin can be produced commercial using a range of methods. The traditional method involves extracting capsaicin from the placental tissue of chili peppers. The process includes drying, grinding, and solvent extraction. It can also be synthesised chemically, which allows for large-scale production. This method involves the synthesis of vanillylamine and 8-methyl-6-nonenoic acid, which are then combined to form capsaicin. New techniques such as in vitro callus cultivation, elicitor treatments, and the use of immobilized cell systems have also been used for capsaicin production. In addition, some companies have developed fermentation processes to produce capsaicin. This approach involves using genetically engineered microorganisms to produce capsaicin and related capsaicinoids. |
|
|
Measured GHG emissions data for capsaicin production are not available. Based on similar chemicals and processes, a rough estimate is in the region of 1.1-1.4 kg CO₂e per kg of capsaicin. |
|
|
|
|
|
|
|
|
|
|
10.3 |
|
Moderate |
|
|
- |
- |
- |
|
|
65 |
|
- |
|
|
215 |
|
- |
|
|
- |
- |
- |
|
|
112.8 |
E3 E = Manufacturers safety data sheets 3 = Unverified data of known source (closed cup) |
- |
|
|
|
3.02 X 1000 |
Calculated |
- |
|
|
0.48 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
5 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
General literature quote soil DT₅₀ as between 2 and 8 days on sandy loam soil |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
|
Slightly mobile |
|
|
1100 |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Known groundwater metabolites |
|
None
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
97.4 |
Mouse |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 0.1 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source |
High |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
9.74 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
No data |
No data for temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
97.4 |
Mouse |
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
515 |
Mouse |
- |
|
|
- |
- |
- |
|
|
Intraperitoneal LD₅₀ = 9.5 mg kg⁻¹ |
Rat |
- |
| Subcutaneous LD₅₀ = 9.0 mg kg⁻¹ |
Mouse |
- |
|
|
0.006 |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
May occur by ingestion of foods containing paprika or cayenne spices which contain this compound |
|
|
May occur through dermal contact |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E1 E = Unspecified genotoxicity type (miscellaneous data source) 1 = Positive |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
✓Yes, known to cause a problem |
✓Yes, known to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
✓Yes, known to cause a problem |
No data found |
  |
|
|
|
May cause vomiting and diarrhoea May cause breathing difficulties May cause significant pulmonary irritation and prolonged cough Studies suggest the carcinogenic potential of capsaicin is quite low |
|
|
|
|
|
Corrosive IMDG Transport Hazard Class 6.1 |
|
|
Health: H302, H315, H319, H335, H372 |
|
|
Not listed |
|
|
UN2811 |
|
|
Packaging Group III (minor danger) |
|
|
- |
|
|
|
|
|
capsaicin |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
13/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.