| Streptomycin |

Last updated: 23/10/2025
|
 |
(Also known as: streptomycine; streptamine; streptomycin A ; Crop antibiotic) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
  |
|
|
Streptomycin is used to combat the growth of bacteria, fungi, and algae on a wide range of crops. It also has applications as a drug specifically as a bactericidal antibiotic. |
|
|
Bacterial shot-hole; Bacterial rots; Bacterial canker; Bacterial wilts; Fire blight |
|
|
Top fruit; Stone fuit; Citrus; Olives; Vegetables; Potatoes; Tobacco; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not approved |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not approved |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Yes |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Streptomycin exhibits stereoisomerism, which arises from its multiple chiral centres. Structurally, it is an aminoglycoside antibiotic composed of three key moieties: streptidine, streptose, and N-methyl-L-glucosamine, all of which contain several chiral centres. The spatial arrangement of these groups is critical for its biological activity, particularly its ability to bind to the 30S subunit of bacterial ribosomes and disrupt protein synthesis. While streptomycin itself is typically used as a single stereoisomer in clinical settings, its biosynthesis by Streptomyces griseus can theoretically yield different stereoisomeric forms. However, only the naturally occurring stereoisomer has the desired antibiotic activity. |
|
|
C₂₁H₃₉N₇O₁₂ |
|
|
CC1C(C(C(O1)OC2C(C(C(C(C2O)O)N=C(N)N)O)N=C(N)N)OC3C(C(C(C(O3)CO)O)O)NC)(C=O)O |
|
|
C[C@@H]1[C@]([C@@H]([C@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)N=C(N)N)O)N=C(N)N)O[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)NC)(C=O)O |
|
|
UCSJYZPVAKXKNQ-APUVXCOVSA-N |
|
|
InChI=1S/C21H39N7O12/c1-5-21(36,4-30)16(40-17-9(26-2)13(34)10(31)6(3-29)38-17)18(37-5)39-15-8(28-20(24)25)11(32)7(27-19(22)23)12(33)14(15)35/h4-18,26,29,31-36H,3H2,1-2H3,(H4,22,23,27)(H4,24,25,28)/t5-,6-,7-,8+,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,21+/m1/s1 |
|
|
Yes |
|
|
Fungicide; Veterinary substance; Crop antibiotic; Other substance |
|
|
Other substance |
|
|
Micro-organism |
|
|
- |
|
|
- |
|
|
Natural |
|
|
A aminoglycoside that inhibites protein biosynthesis, systemic action |
|
|
Isolated from the soil actinomycete, Streptomyces griseus |
|
|
Crop protection |
|
|
Bacterial shot-hole; Bacterial rots; Bacterial canker; Bacterial wilts; Fire blight |
|
|
Top fruit; Stone fuit; Citrus; Olives; Vegetables; Potatoes; Tobacco; Ornamentals |
|
|
- |
|
|
57-92-1 |
|
|
200-355-3 |
|
|
312 |
|
|
006306 |
|
|
19649 |
|
|
581.57 |
|
|
- |
|
|
O-2-deoxy-2-methylamino-α-L-glucopyranosyl-(1-2)-O-5-deoxy-3-C-formyl-α-L-lyxofuranosyl-(1-4)-N1,N3-diamidino-D-streptamine |
|
|
O-2-deoxy-2-(methylamino)-α-L-glucopyranosyl-(1-2)-O-5-deoxy-3-C-formyl-α-L-lyxofuranosyl-(1-4)-N,N'-bis(aminoiminomethyl)-D-streptamine |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
BM02 |
|
|
Resistance is widespread |
|
|
White powder |
|
|
|
|
|
|
|
|
- |
|
|
1944, first reported; 1958, commericalised USA |
|
|
- Syngenta AG
- Amvac
- Aries agro Ltd
- Nufarm Ltd
- Norbrook Labs;
|
|
|
- Agrept
- AS-50
- Plantomycin
- Agrimycin 17
- Pen & Strep Injection
- AdvaCare Pharma
|
|
|
It is available as a water soluble powder, pellets or as an emulsifiable concentrate. Applied as a foliar spray for crop protection. For animal health it is usually formulated as a solution for injection. |
|
|
Commerically, streptomycin is produced uses a fermentation process based on Streptococcus griseus together with a natural source of carbon and nitrogen, and a growth stimulating compound |
|
|
As microbial-based products tend to use fermentation-based production processes rather than chemical synthesis, they typically have a lower fossil fuel input in formulation and active ingredient creation, and also have reduced downstream emissions due to biodegradability and minimal soil disruption, their life-cycle GHG emissions are expected to be low. Whilst hard and precise data is not available, broad estimates suggest that typically emissions are likely to be below 5 kg CO₂e/kg. |
|
|
|
|
|
|
|
|
|
|
1000000 |
at 25 °C |
High |
|
|
- |
- |
- |
|
|
12 |
Q3 Q = Miscellaneous data from online sources 3 = Unverified data of known source |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
3.16 X 10-08 |
Calculated |
- |
|
|
-7.5 |
|
Low |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
n/a |
- |
- |
| - |
|
|
7.76 X 10-23 |
at 25 °C |
Low volatility |
|
|
8.52 X 10-39 |
at 25 °C |
Non-volatile |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
- |
- |
- |
|
|
1.0 |
|
Non-persistent |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
- |
|
Moderately mobile |
|
|
339 |
|
|
- |
|
|
- |
|
|
- |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 9000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 4640 |
E4 E = Manufacturers safety data sheets 4 = Verified data Anas platyrhynchos |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
> 180 |
E4 E = Manufacturers safety data sheets 4 = Verified data Oncorhynchus mykiss |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
487 |
R4 R = Peer reviewed scientific publications 4 = Verified data Daphnia magna |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
0.133 |
R4 R = Peer reviewed scientific publications 4 = Verified data Raphidocelis subcapitata |
Moderate |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) used to calculate Total Applied Toxicity (TAT) |
|
|
|
|
|
|
|
900 |
Worst case of acute and chronic mammals |
|
|
464 |
Worst case of acute and chronic birds |
|
|
No data |
No data for acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
1.8 |
Worst case of temperate acute and chronic fish |
|
|
4.87 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
0.0133 |
Worst case of free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 9000 |
Rat |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
325 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Mouse |
- |
|
|
- |
- |
- |
|
|
Intraperitoneal LD₅₀ = 525 mg kg⁻¹ |
Mouse |
- |
| Intravenous LDLo = 175 mg kg⁻¹ |
Rat |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
Majority of oral dose is excreted in the faeces. Parenteral administration leads to urinal elimination. |
R4 R = Peer reviewed scientific publications 4 = Verified data |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
| No data found |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E0 E = Unspecified genotoxicity type (miscellaneous data source) 0 = No data |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
?Possibly, status not identified |
No data found |
?Possibly, status not identified |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
?Possibly, status not identified |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
May cause rashes, hives, headache, drop in blood pressure, nausea and vomiting Possible kidney toxicant May cause hearing dysfunction |
|
|
|
|
|
No information available |
|
|
Health: H302, H361, H373 |
|
|
Not listed (Not listed) |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
streptomycin |
|
|
streptomycine |
|
|
Streptomyzin |
|
|
- |
|
|
streptomicina |
|
|
estreptomicina |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
23/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |