| Spinosyn B |

Last updated: 23/10/2025
|
 |
(Not known by any other names) |
The following Pesticide Hazard Tricolour (PHT) alerts are based on the data in the tables below. An absence of an alert does not imply the substance has no implications for human health, biodiversity or the environment but just that we do not have the data to form a judgement. The alerts for Highly Hazardous Pesticides (HHPs) are based on applying the FAO/WHO (Type 1) and the PAN (Type II) criteria to PPDB data. Further details on the HHP indicators are given in the tables below. Neither the PHT nor the HHP hazard alerts take account of usage patterns or exposure, thus they do not represent risk.
| PHT: Environmental fate |
PHT: Ecotoxicity |
PHT: Human health |
Highly Hazardous Pesticide |
|
|
|
|
|
|
A soil bacterium with insecticidal properties that is also a chemical transformation product of spinosad |
|
|
Caterpillars; Thrips; Flies; Termites; Ants; Lice; Grasshoppers |
|
|
Vegetables; Fruit; Turf; Vines; Ornamentals |
|
|
- |
|
|
- |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
No UK approval for use as a plant protection agent |
| EC Regulation 1107/2009 (repealing 91/414) |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
Not applicable |
|
|
No |
|
|
ATAustria |
BEBelgium |
BGBulgaria |
CYCyprus |
CZCzech Republic |
DEGermany |
DKDenmark |
EEEstonia |
ELGreece |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
ESSpain |
FIFinland |
FRFrance |
HRCroatia |
HUHungary |
IEIreland |
ITItaly |
LTLithuania |
LULuxembourg |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
LVLatvia |
MTMalta |
NLNetherlands |
PLPoland |
PTPortugal |
RORomania |
SESweden |
SISlovenia |
SKSlovakia |
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
ISIceland |
NONorway |
|
|
|
|
|
|
|
|   |
  |
  |
  |
  |
  |
  |
  |
  |
|
|
|
Chiral, a specific isomer or a derivative of a chiral molecule |
|
|
C₄₀H₆₃NO₁₀ |
|
|
CCC1CCCC(C(C(=O)C2=CC3C4CC(CC4C=CC3C2CC(=O)O1)OC5C(C(C(C(O5)C)OC)OC)OC)C)OC6CCC(C(O6)C)NC |
|
|
CC[C@H]1CCC[C@@H]([C@H](C(=O)C2=C[C@H]3[C@@H]4C[C@@H](C[C@H]4C=C[C@H]3[C@@H]2CC(=O)O1)O[C@H]5[C@@H]([C@@H]([C@H]([C@@H](O5)C)OC)OC)OC)C)O[C@H]6CC[C@@H]([C@H](O6)C)NC |
|
|
VESRDXZDAAOUHS-KXRJSVEISA-N |
|
|
InChI=1S/C40H63NO10/c1-9-25-11-10-12-33(51-35-16-15-32(41-5)22(3)47-35)21(2)36(43)31-19-29-27(30(31)20-34(42)49-25)14-13-24-17-26(18-28(24)29)50-40-39(46-8)38(45-7)37(44-6)23(4)48-40/h13-14,19,21-30,32-33,35,37-41H,9-12,15-18,20H2,1-8H3/t21-,22-,23+,24-,25+,26-,27-,28-,29-,30+,32+,33+,35+,37+,38-,39-,40+/m1/s1 |
|
|
Yes |
|
|
Metabolite; Insecticide |
|
|
Soil; Surface water; Groundwater; |
|
|
Micro-organism derived substance |
|
|
- |
|
|
- |
|
|
Natural |
|
|
Once absorbed or ingested by target insects, spinosad causes prolonged involuntary muscle contractions and tremors, resulting in neuromuscular fatigue, paralysis and death. Nicotinic acetylcholine receptor (nAChR) channel blocker - site I |
|
|
- |
|
|
A secondary metabolite of the soil bacterium Saccharopolyspora spinosa Mertz and Yoa. |
|
|
Crop protection |
|
|
Suitable for use in all farming systems where approved for use in that country |
|
|
131929-61-8 |
|
|
- |
|
|
- |
|
|
110004 |
|
|
- |
|
|
717.94 |
|
|
- |
|
|
(2R,3aS,5aR,5bS,9S,13S,14R,16aS,16bR)-9-ethyl-14-methyl-13-{[(2R,5S,6R)-6-methyl-5-(methylamino)tetrahydro-2H-pyran-2-yl]oxy}-7,15-dioxo-2,3,3a,5a,5b,6,7,9,10,11,12,13,14,15,16a,16b-hexadecahydro-1H-as-indaceno[3,2-d] |
|
|
spinosyn B |
|
|
| UK Poisons List Order 1972 |
Rotterdam Convention |
Montreal Protocol |
|
|
|
| Stockholm Convention |
OSPAR |
EU Water Framework Directive |
|
|
|
|
|
|
- |
|
|
- |
|
|
|
- |
|
|
Yes [ R11 Rule 11: Pesticide active ingredients that are environmentally persistent (where sediment phase only DT₅₀ => 90 days or water phase only DT₅₀ => 90 days or DT₅₀ (field) => 60 days (note lab values are used when field values are not available)) ] |
|
|
- |
|
|
Not applicable |
|
|
Not applicable |
|
|
5 |
|
|
Not applicable |
|
|
- |
|
|
Solid |
|
|
|
|
|
Current |
|
|
1997, spinosyns first used in crop protection |
|
|
- Dow Agrosciences
- Southern Agricultural Insecticides, Inc.
- Elanco Animal Health
|
|
|
- Conserve SC specialty insecticide
- Conserve Naturalyte insecticide with spinosad
- Extinosad Pour-On for Sheep
|
|
|
Formulated with spinosyn A as aqueous suspension concentrates |
|
|
Spinosyn B is produced commercially through a fermentation process involving the bacterium Saccharopolyspora spinosa. The bacterium is cultured in large fermentation tanks. During this process, the bacteria produce spinosyns, including spinosyn B, as secondary metabolites. After fermentation, the spinosyns are extracted from the fermentation broth using filtration and solvent extraction to isolate the desired compounds. The extracted spinosyns are then purified, typically using chromatography, to separate spinosyn B from other spinosyns and impurities. |
|
|
Products based on fermentation processes rather than chemical synthesis, have a lower fossil fuel input in formulation and active ingredient creation, and have reduced downstream emissions due to biodegradability and minimal soil disruption, the life-cycle GHG emissions are expected to be low. Whilst hard and precise data are not available, broad estimates suggest that typically emissions are likely to be below 5 kg CO₂e/kg. |
|
|
|
|
|
|
|
|
|
|
250000 |
|
High |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
Soluble |
|
- |
|
|
Regulatory data - observed in metabolism and farm animal feeding studies |
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
| - |
|
|
0.001 |
|
Low volatility |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
|
|
|
|
- |
|
|
|
66.1 |
|
Moderately persistent |
|
|
66.1 |
|
Moderately persistent |
|
|
- |
- |
- |
|
|
181.5 |
|
Persistent |
|
|
- |
- |
- |
|
|
201 |
worst case |
- |
|
|
EU 2025 dossier Lab studies DT₅₀ (normalised) range 33.3-146 days, Soils=10; DT₉₀ (measured) range 115.3-212.3 days, Soils=4 |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
As this parameter is not normally measured directly, a surrogate measure is used: ‘Photochemical oxidative DT₅₀’. Where data is available, this can be found in the Fate Indices section below. |
|
|
- |
| Soil adsorption and mobility |
|
|
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
|
|
|
29.0 |
|
Slightly mobile |
|
|
2515 |
|
|
0.83 |
|
|
EU 2025 dossier Kf range 4.3-312.6 mL g⁻¹, Kfoc range 672-44655 mL g⁻¹, 1/n range 0.77-0.80, Soils=9 |
|
|
No |
None
| Terrestrial ecotoxicology |
|
|
|
|
|
|
|
> 2000 |
Mouse |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
1.79 |
Eisenia foetida |
Moderate |
|
|
Nitrogen mineralisation: No significant adverse effect Carbon mineralisation: No significant adverse effect |
Dose: 3.582 mg kg⁻¹ soil |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
| - |
|
|
- |
- |
- |
| - |
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
|
- |
- |
- |
|
|
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
|
- |
|
- |
- |
- |
|
|
- |
|
|
|
|
|
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
6.5 |
Daphnia magna |
Moderate |
|
|
0.001 |
Daphnia magna |
High |
|
|
- |
- |
- |
|
|
2.2 |
Americamysis bahia |
Moderate |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
- |
- |
|
- |
- |
- |
|
|
- |
- |
- |
| Regulatory Threshold Levels (RTLs) |
|
Note: These RTLs have been calculated using the regulatory approach used in the European Union and based on ecotoxocity values in the PPDB.
|
|
|
|
|
|
200 |
Worst case of acute and chronic mammals |
|
|
No data |
No data for acute and chronic birds |
|
|
0.358 |
Worst case of acute and chronic earthworms |
|
|
No data |
No data for non-target plants vegetative vigour and seedling emergence |
|
|
No data |
No data for contact and oral honeybees |
|
|
No data |
No data for parasitic wasps and predatory mites |
|
|
No data |
No data for temperate acute and chronic fish |
|
|
0.0001 |
Worst case of temperate acute and chronic aquatic invertebrates |
|
|
No data |
No data for free-floating plants, rooted plants, acute and chronic algae |
| HUMAN HEALTH AND PROTECTION |
|
|
|
|
|
|
|
|
|
High (class III) |
- |
- |
|
|
> 2000 |
Mouse |
Low |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
> 5000 |
L3 L = Pesticide manuals and hard copy reference books / other sources 3 = Unverified data of known source Rabbit |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
- |
- |
- |
|
|
|
- |
|
|
- |
|
|
- |
- |
- |
|
|
| Carcinogen |
|
Endocrine disruptor |
XNo, known not to cause a problem |
A0 A = Chromosome aberration (EFSA database) 0 = No data ; B0 B = DNA damage/repair (EFSA database) 0 = No data ; C0 C = Gene mutation (EFSA database) 0 = No data ; D0 D = Genome mutation (EFSA database) 0 = No data ; E3 E = Unspecified genotoxicity type (miscellaneous data source) 3 = Negative |
No data found |
| Reproduction / development effects |
Acetyl cholinesterase inhibitor |
Neurotoxicant |
XNo, known not to cause a problem |
XNo, known not to cause a problem |
No data found |
| Respiratory tract irritant |
Skin irritant |
Skin sensitiser |
| No data found |
XNo, known not to cause a problem |
?Possibly, status not identified |
| Eye irritant |
Phototoxicant |
  |
?Possibly, status not identified |
No data found |
  |
|
|
|
No further information available |
|
|
|
|
|
No information available |
|
|
Health: H302 Environment: H410 |
|
|
Not listed |
|
|
- |
|
|
- |
|
|
- |
|
|
|
|
|
spinosyn B |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
|
|
- |
| Record last updated: |
23/10/2025 |
| Contact: |
aeru@herts.ac.uk |
| Please cite as: |
Lewis, K.A., Tzilivakis, J., Warner, D. and Green, A. (2016) An international database for pesticide risk assessments and management. Human and Ecological Risk Assessment: An International Journal, 22(4), 1050-1064. DOI: 10.1080/10807039.2015.1133242 |
© Copyright University of Hertfordshire, 2006-2026. All Rights Reserved
Your use of this website and its various databases is subject to the terms detailed in the University of Hertfordshire’s copyright and IPR statement that can be found at
https://www.herts.ac.uk/about-us/legal.
In addition, your use of this website and its various databases is subject to the terms of this additional Copyright Statement and the database
Conditions of use document.
Unless explicitly stated otherwise, the content of this website and databases are owned and controlled by the University of Hertfordshire. Site content, including its selection and arrangement, is owned by the University of Hertfordshire and is protected by copyright and other laws.
Except as otherwise expressly permitted under copyright law or within the database Conditions of Use document, the content of this site may not be copied, reproduced, republished, downloaded, posted, broadcast or transmitted in any way without first obtaining the University of Hertfordshire’s written permission.
By using our databases the user is deemed to have agreed to comply with all of the terms and conditions as described above and within all relevant documentation.